CAS 1164475-05-1 is the registry number for N-((1S,2R)-2-Phenylcyclopropyl)-acetamide. Offered by: TRC. Available pack sizes: 500mg.
N-[(1S,2R)-2-phenylcyclopropyl]acetamide (CAS 1164475-05-1) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: N-[(1S,2R)-2-phenylcyclopropyl]acetamide. InChIKey: OKNYZIGDRLPEEJ-MNOVXSKESA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | N-[(1S,2R)-2-phenylcyclopropyl]acetamide |
| InChIKey | OKNYZIGDRLPEEJ-MNOVXSKESA-N |
| SMILES | CC(=O)N[C@H]1C[C@@H]1C2=CC=CC=C2 |
Computed by PubChem (NCBI)