CAS 1164528-69-1 is the registry number for 4-Oxo-3-(pyridin-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.0(1,5)]dec-8-ene-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-oxo-3-(pyridin-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid (CAS 1164528-69-1) is a chemical compound with the molecular formula C15H14N2O4 and a molecular weight of 286.28 g/mol. IUPAC name: 4-oxo-3-(pyridin-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid. InChIKey: XSEHIJHACSPQOL-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O4 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 4-oxo-3-(pyridin-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
| InChIKey | XSEHIJHACSPQOL-UHFFFAOYSA-N |
| SMILES | C1C23C=CC(O2)C(C3C(=O)N1CC4=CC=CC=N4)C(=O)O |
Computed by PubChem (NCBI)