CAS 241809-79-0 appears in our catalog under these names: 4-[(Pyridin-3-ylmethoxycarbonylamino)methyl]benzoic acid, 95%, 4–((((Pyridin–3–ylmethoxy)carbonyl)amino)methyl)benzoic acid, 4-((((pyridin-3-ylmethoxy)carbonyl)amino)methyl)benzoic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
4-[(pyridin-3-ylmethoxycarbonylamino)methyl]benzoic acid (CAS 241809-79-0) is a chemical compound with the molecular formula C15H14N2O4 and a molecular weight of 286.28 g/mol. IUPAC name: 4-[(pyridin-3-ylmethoxycarbonylamino)methyl]benzoic acid. InChIKey: HZUDHRTWQOKGOX-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O4 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 4-[(pyridin-3-ylmethoxycarbonylamino)methyl]benzoic acid |
| InChIKey | HZUDHRTWQOKGOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)COC(=O)NCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)