CAS 116525-66-7 appears in our catalog under these names: 3-(4-Chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-carboxylic acid, 95%, 3-(4-Chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-carboxylic acid, 97% , 3-(4-Chlorophenyl)-4-cyano-5-(methylthio)thiophene-2-carboxylic acid, 98%. Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3-(4-chlorophenyl)-4-cyano-5-methylsulfanylthiophene-2-carboxylic acid (CAS 116525-66-7) is a chemical compound with the molecular formula C13H8ClNO2S2 and a molecular weight of 309.8 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-cyano-5-methylsulfanylthiophene-2-carboxylic acid. InChIKey: CCQQTQYIJRVXIU-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO2S2 |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4-cyano-5-methylsulfanylthiophene-2-carboxylic acid |
| InChIKey | CCQQTQYIJRVXIU-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(S1)C(=O)O)C2=CC=C(C=C2)Cl)C#N |
Computed by PubChem (NCBI)