CAS 565216-92-4 is the registry number for 2-((4-Chlorophenyl)sulfonyl)-3-(2-thienyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 5000mg.
(E)-2-(4-chlorophenyl)sulfonyl-3-thiophen-2-ylprop-2-enenitrile (CAS 565216-92-4) is a chemical compound with the molecular formula C13H8ClNO2S2 and a molecular weight of 309.8 g/mol. IUPAC name: (E)-2-(4-chlorophenyl)sulfonyl-3-thiophen-2-ylprop-2-enenitrile. InChIKey: ZYOKZRRZBHAMJD-MDWZMJQESA-N.
| Molecular formula | C13H8ClNO2S2 |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | (E)-2-(4-chlorophenyl)sulfonyl-3-thiophen-2-ylprop-2-enenitrile |
| InChIKey | ZYOKZRRZBHAMJD-MDWZMJQESA-N |
| SMILES | C1=CSC(=C1)/C=C(\C#N)/S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)