CAS 116568-17-3 appears in our catalog under these names: 1H-Benzo[d]imidazole-6-carboxamide, 95%, 95%, 1H-Benzoimidazole-5-carboxylic acid amide, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
3H-benzimidazole-5-carboxamide (CAS 116568-17-3) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 3H-benzimidazole-5-carboxamide. InChIKey: FNLQDVXHDNFXIY-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3H-benzimidazole-5-carboxamide |
| InChIKey | FNLQDVXHDNFXIY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)N)NC=N2 |
Computed by PubChem (NCBI)