CAS 1165935-93-2 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(2,4,5-trichlorophenyl)-1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-(2,4,5-trichlorophenyl)-1,3,2-dioxaborolane, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 100mg, 5g, 1g, 10g.
4,4,5,5-tetramethyl-2-(2,4,5-trichlorophenyl)-1,3,2-dioxaborolane (CAS 1165935-93-2) is a chemical compound with the molecular formula C12H14BCl3O2 and a molecular weight of 307.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,4,5-trichlorophenyl)-1,3,2-dioxaborolane. InChIKey: WIBZNSKYKWUKKM-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl3O2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,4,5-trichlorophenyl)-1,3,2-dioxaborolane |
| InChIKey | WIBZNSKYKWUKKM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)