CAS 942069-95-6 appears in our catalog under these names: 3,4,5-Trichlorophenylboronic acid, pinacol ester, 96%, 3,4,5–Trichlorophenylboronic Acid Pinacol Ester, 3,4,5-Trichlorophenylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane 96%, 4,4,5,5-Tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane, 96%, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 25g, 100g.
4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane (CAS 942069-95-6) is a chemical compound with the molecular formula C12H14BCl3O2 and a molecular weight of 307.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane. InChIKey: OTPVENHYVDCFAO-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl3O2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-trichlorophenyl)-1,3,2-dioxaborolane |
| InChIKey | OTPVENHYVDCFAO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)