CAS 116668-69-0 appears in our catalog under these names: 3–Bromodibenzo(b,d)thiophene 5,5–dioxide, 3-Bromodibenzothiophene 5,5-Dioxide, >98.0%(GC), 3-Bromodibenzothiophene 5,5-Dioxide, 3-Bromodibenzo[b,d]thiophene 5,5-dioxide 97%, 3-Bromodibenzo[b,d]thiophene 5,5-dioxide, 97%, 97%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 200mg, 25mg, 50mg, 100mg, 250mg, 500mg.
3-bromodibenzothiophene 5,5-dioxide (CAS 116668-69-0) is a chemical compound with the molecular formula C12H7BrO2S and a molecular weight of 295.15 g/mol. IUPAC name: 3-bromodibenzothiophene 5,5-dioxide. InChIKey: XHRCPNQYOKMDIP-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO2S |
|---|---|
| Molecular weight | 295.15 g/mol |
| IUPAC name | 3-bromodibenzothiophene 5,5-dioxide |
| InChIKey | XHRCPNQYOKMDIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2(=O)=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)