CAS 53846-85-8 appears in our catalog under these names: 2-Bromodibenzothiophene 5,5-dioxide, 95%, 2–Bromodibenzo(b,d)thiophene 5,5–dioxide, 2-Bromodibenzothiophene 5,5-Dioxide, >95.0%(GC), 2-Bromodibenzothiophene 5,5-Dioxide, 2-Bromodibenzothiophene 5,5-dioxide 95%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 200mg, 100mg, 250mg, 500mg, 1000mg, 2000mg, 5g.
2-bromodibenzothiophene 5,5-dioxide (CAS 53846-85-8) is a chemical compound with the molecular formula C12H7BrO2S and a molecular weight of 295.15 g/mol. IUPAC name: 2-bromodibenzothiophene 5,5-dioxide. InChIKey: WRKJLRFOQLWYOW-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO2S |
|---|---|
| Molecular weight | 295.15 g/mol |
| IUPAC name | 2-bromodibenzothiophene 5,5-dioxide |
| InChIKey | WRKJLRFOQLWYOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2(=O)=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)