CAS 1166827-44-6 appears in our catalog under these names: Azd7687, 95%, AZD7687, AZD7687, 99.80%, 99.80%, AZD7687, 99.38%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 2mg, 10mM/1mL, 5 mg, 10 mg.
2-[4-[4-(6-carbamoyl-3,5-dimethylpyrazin-2-yl)phenyl]cyclohexyl]acetic acid (CAS 1166827-44-6) is a chemical compound with the molecular formula C21H25N3O3 and a molecular weight of 367.4 g/mol. IUPAC name: 2-[4-[4-(6-carbamoyl-3,5-dimethylpyrazin-2-yl)phenyl]cyclohexyl]acetic acid. InChIKey: YXFNPRHZMOGREC-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O3 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 2-[4-[4-(6-carbamoyl-3,5-dimethylpyrazin-2-yl)phenyl]cyclohexyl]acetic acid |
| InChIKey | YXFNPRHZMOGREC-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C)C(=O)N)C2=CC=C(C=C2)C3CCC(CC3)CC(=O)O |
Computed by PubChem (NCBI)