CAS 261944-46-1 appears in our catalog under these names: Soraprazan (BYK61359), Soraprazan, 98%, Soraprazan, Soraprazan, 99.78%, Soraprazan (Standard). Offered by: GLPBio, AmBeed, TRC, TargetMol, Biosynth. Available pack sizes: 1mg, 100mg, 25mg, 5mg, 50mg, 10mg, 10mM (in 1ml dmso), 2mg.
(7R,8R,9R)-7-(2-methoxyethoxy)-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol (CAS 261944-46-1) is a chemical compound with the molecular formula C21H25N3O3 and a molecular weight of 367.4 g/mol. IUPAC name: (7R,8R,9R)-7-(2-methoxyethoxy)-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol. InChIKey: PWILYDZRJORZDR-MISYRCLQSA-N.
| Molecular formula | C21H25N3O3 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (7R,8R,9R)-7-(2-methoxyethoxy)-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol |
| InChIKey | PWILYDZRJORZDR-MISYRCLQSA-N |
| SMILES | CC1=C(N2C=CC3=C(C2=N1)N[C@@H]([C@H]([C@@H]3OCCOC)O)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)