CAS 1167056-59-8 is the registry number for 2–Oxo–2,3–dihydro–1H–pyrrolo(3,2–b)pyridine–5–carbonitrile. Offered by: GLPBio. Available pack sizes: 100mg.
2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carbonitrile (CAS 1167056-59-8) is a chemical compound with the molecular formula C8H5N3O and a molecular weight of 159.14 g/mol. IUPAC name: 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carbonitrile. InChIKey: JRUDEYDNMPKRTB-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carbonitrile |
| InChIKey | JRUDEYDNMPKRTB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=N2)C#N)NC1=O |
Computed by PubChem (NCBI)