CAS 116707-99-4 is the registry number for 5-Methoxy-1,3-dimethylindolin-2-one, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 5g.
5-methoxy-1,3-dimethyl-3H-indol-2-one (CAS 116707-99-4) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 5-methoxy-1,3-dimethyl-3H-indol-2-one. InChIKey: OEFXMHVYDQGQRW-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5-methoxy-1,3-dimethyl-3H-indol-2-one |
| InChIKey | OEFXMHVYDQGQRW-UHFFFAOYSA-N |
| SMILES | CC1C2=C(C=CC(=C2)OC)N(C1=O)C |
Computed by PubChem (NCBI)