CAS 116763-35-0 is the registry number for 5(6)-Carboxyrhodamine 110. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-amino-6-iminoxanthen-9-yl)benzene-1,3-dicarboxylic acid (CAS 116763-35-0) is a chemical compound with the molecular formula C21H14N2O5 and a molecular weight of 374.3 g/mol. IUPAC name: 4-(3-amino-6-iminoxanthen-9-yl)benzene-1,3-dicarboxylic acid. InChIKey: ONTCUDVUGYVDSS-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O5 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 4-(3-amino-6-iminoxanthen-9-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | ONTCUDVUGYVDSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)C2=C3C=CC(=N)C=C3OC4=C2C=CC(=C4)N |
Computed by PubChem (NCBI)