CAS 1172349-47-1 is the registry number for 5-(4-Aminophenoxy)-2-(benzo[d][1,3]dioxol-5-yl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-aminophenoxy)-2-(1,3-benzodioxol-5-yl)isoindole-1,3-dione (CAS 1172349-47-1) is a chemical compound with the molecular formula C21H14N2O5 and a molecular weight of 374.3 g/mol. IUPAC name: 5-(4-aminophenoxy)-2-(1,3-benzodioxol-5-yl)isoindole-1,3-dione. InChIKey: DCXSXEWRXWWETC-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O5 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5-(4-aminophenoxy)-2-(1,3-benzodioxol-5-yl)isoindole-1,3-dione |
| InChIKey | DCXSXEWRXWWETC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N3C(=O)C4=C(C3=O)C=C(C=C4)OC5=CC=C(C=C5)N |
Computed by PubChem (NCBI)