CAS 1168133-05-8 appears in our catalog under these names: Phenazopyridine Impurity 8, Phenazopyridine Impurity 2, 3-Phenylphenazopyridine. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 250mg.
3-phenyl-5-phenyldiazenylpyridine-2,6-diamine (CAS 1168133-05-8) is a chemical compound with the molecular formula C17H15N5 and a molecular weight of 289.33 g/mol. IUPAC name: 3-phenyl-5-phenyldiazenylpyridine-2,6-diamine. InChIKey: RBGZGPSVFJKROH-UHFFFAOYSA-N.
| Molecular formula | C17H15N5 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 3-phenyl-5-phenyldiazenylpyridine-2,6-diamine |
| InChIKey | RBGZGPSVFJKROH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(N=C2N)N)N=NC3=CC=CC=C3 |
Computed by PubChem (NCBI)