CAS 866820-63-5 is the registry number for 4-[(E)-2-Phenylvinyl]-1,4-dihydro[1,3,5]triazino[1,2-a]benzimidazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(E)-2-phenylethenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (CAS 866820-63-5) is a chemical compound with the molecular formula C17H15N5 and a molecular weight of 289.33 g/mol. IUPAC name: 4-[(E)-2-phenylethenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine. InChIKey: YKEVULXNKMWCPY-ZHACJKMWSA-N.
| Molecular formula | C17H15N5 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 4-[(E)-2-phenylethenyl]-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| InChIKey | YKEVULXNKMWCPY-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2N=C(NC3=NC4=CC=CC=C4N23)N |
Computed by PubChem (NCBI)