CAS 1169393-54-7 is the registry number for (S)-1-(Benzo[d]thiazol-2-yl)ethan-1-amine, 97%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg.
(1S)-1-(1,3-benzothiazol-2-yl)ethanamine (CAS 1169393-54-7) is a chemical compound with the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. IUPAC name: (1S)-1-(1,3-benzothiazol-2-yl)ethanamine. InChIKey: LXVJOKQWUUSEEO-LURJTMIESA-N.
| Molecular formula | C9H10N2S |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | (1S)-1-(1,3-benzothiazol-2-yl)ethanamine |
| InChIKey | LXVJOKQWUUSEEO-LURJTMIESA-N |
| SMILES | C[C@@H](C1=NC2=CC=CC=C2S1)N |
Computed by PubChem (NCBI)