CAS 116956-35-5 is the registry number for Sodium 4-phenylbutane-1-sulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 4-phenylbutane-1-sulfonate (CAS 116956-35-5) is a chemical compound with the molecular formula C10H13NaO3S and a molecular weight of 236.27 g/mol. IUPAC name: sodium 4-phenylbutane-1-sulfonate. InChIKey: YRAORIWYNOYXFQ-UHFFFAOYSA-M.
| Molecular formula | C10H13NaO3S |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | sodium 4-phenylbutane-1-sulfonate |
| InChIKey | YRAORIWYNOYXFQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CCCCS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)