CAS 128309-26-2 is the registry number for Sodium 4-tert-butylbenzenesulfonate. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g.
Sodium 4-tert-butylbenzenesulfonate (CAS 128309-26-2) is a chemical compound with the molecular formula C10H13NaO3S and a molecular weight of 236.27 g/mol. IUPAC name: sodium 4-tert-butylbenzenesulfonate. InChIKey: WWNNTRKNZRMYDL-UHFFFAOYSA-M.
| Molecular formula | C10H13NaO3S |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | sodium 4-tert-butylbenzenesulfonate |
| InChIKey | WWNNTRKNZRMYDL-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)