CAS 1169762-40-6 is the registry number for Phenylmethyl (3R)-3-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methyl-1-piperidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
Benzyl (3R)-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (CAS 1169762-40-6) is a chemical compound with the molecular formula C19H28N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: benzyl (3R)-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate. InChIKey: ANZPQADKWPBRBT-LJQANCHMSA-N.
| Molecular formula | C19H28N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | benzyl (3R)-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| InChIKey | ANZPQADKWPBRBT-LJQANCHMSA-N |
| SMILES | C[C@]1(CCCN(C1)C(=O)OCC2=CC=CC=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)