CAS 1207455-37-5 appears in our catalog under these names: 4-Benzyl 1-tert-butyl 2,6-dimethylpiperazine-1,4-dicarboxylate, 95%, 4-Benzyl 1-(tert-butyl) 2,6-dimethylpiperazine-1,4-dicarboxylate, 95%, 95%, 4-BENZYL 1-TERT-BUTYL 2,6-DIMETHYLPIPERAZINE-1,4-DICARBOXYLATE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-O-benzyl 1-O-tert-butyl 2,6-dimethylpiperazine-1,4-dicarboxylate (CAS 1207455-37-5) is a chemical compound with the molecular formula C19H28N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl 2,6-dimethylpiperazine-1,4-dicarboxylate. InChIKey: BQDWTKGOXJXCIY-UHFFFAOYSA-N.
| Molecular formula | C19H28N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl 2,6-dimethylpiperazine-1,4-dicarboxylate |
| InChIKey | BQDWTKGOXJXCIY-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(N1C(=O)OC(C)(C)C)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)