CAS 1169976-85-5 appears in our catalog under these names: 1-[(3,4-Dichlorophenyl)sulfonyl]piperazine hydrochloride, 95%, 1-(3,4-Dichlorobenzenesulfonyl)piperazine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride (CAS 1169976-85-5) is a chemical compound with the molecular formula C10H13Cl3N2O2S and a molecular weight of 331.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride. InChIKey: RQHDVDKMNZZWCE-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl3N2O2S |
|---|---|
| Molecular weight | 331.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | RQHDVDKMNZZWCE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)