Products 1172060-75-1

CAS 1172060-75-1 is the registry number for 1-[(2,5-Dichlorophenyl)sulfonyl]piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

1-(2,5-dichlorophenyl)sulfonylpiperazine;hydrochloride (CAS 1172060-75-1) is a chemical compound with the molecular formula C10H13Cl3N2O2S and a molecular weight of 331.6 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)sulfonylpiperazine;hydrochloride. InChIKey: HDDCFZNGXFZZJL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13Cl3N2O2S
Molecular weight331.6 g/mol
IUPAC name1-(2,5-dichlorophenyl)sulfonylpiperazine;hydrochloride
InChIKeyHDDCFZNGXFZZJL-UHFFFAOYSA-N
SMILESC1CN(CCN1)S(=O)(=O)C2=C(C=CC(=C2)Cl)Cl.Cl

Computed by PubChem (NCBI)