CAS 117-78-2 appears in our catalog under these names: Anthraquinone–2–carboxylic acid, Anthraquinone-2-carboxylic acid, 98% , Anthraquinone-2-carboxylic acid 95%, ANTHRAQUINONE-2-CARBOXYLIC ACID, 98%, Anthraquinone-2-carboxylic acid, 98.0%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich, MedChemExpress. Available pack sizes: 250mg, 10mM (in 1ml dmso), 500mg, 1g, 5g, 25g, 100g, 1 g.
9,10-dioxoanthracene-2-carboxylic acid (CAS 117-78-2) is a chemical compound with the molecular formula C15H8O4 and a molecular weight of 252.22 g/mol. IUPAC name: 9,10-dioxoanthracene-2-carboxylic acid. InChIKey: ASDLSKCKYGVMAI-UHFFFAOYSA-N.
| Molecular formula | C15H8O4 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 9,10-dioxoanthracene-2-carboxylic acid |
| InChIKey | ASDLSKCKYGVMAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)