CAS 32155-34-3 appears in our catalog under these names: 9,10-Dioxo-9,10-dihydrophenanthrene-3-carboxylic acid, 98%, 9,10-Dioxo-9,10-dihydrophenanthrene-3-carboxylic acid, 97%, 9,10-Dioxo-9,10-dihydrophenanthrene-3-carboxylic acid, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
9,10-dioxophenanthrene-3-carboxylic acid (CAS 32155-34-3) is a chemical compound with the molecular formula C15H8O4 and a molecular weight of 252.22 g/mol. IUPAC name: 9,10-dioxophenanthrene-3-carboxylic acid. InChIKey: DKIFEYAEWKRYFT-UHFFFAOYSA-N.
| Molecular formula | C15H8O4 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 9,10-dioxophenanthrene-3-carboxylic acid |
| InChIKey | DKIFEYAEWKRYFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC(=C3)C(=O)O)C(=O)C2=O |
Computed by PubChem (NCBI)