Products 1170056-22-0
CAS 1170056-22-0 is the registry number for 2-Chloro-n-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;hydrochloride (CAS 1170056-22-0) is a chemical compound with the molecular formula C11H22Cl2N2O and a molecular weight of 269.21 g/mol. IUPAC name: 2-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;hydrochloride. InChIKey: DDFOWEZGORQRJV-UHFFFAOYSA-N.
| Molecular formula | C11H22Cl2N2O |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | 2-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;hydrochloride |
| InChIKey | DDFOWEZGORQRJV-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)NC(=O)CCl)C.Cl |
Computed by PubChem (NCBI)