Products 1268334-84-4

CAS 1268334-84-4 is the registry number for 9-Methyl-3,9-diazaspiro[5.6]dodecan-10-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

9-methyl-3,9-diazaspiro[5.6]dodecan-10-one;dihydrochloride (CAS 1268334-84-4) is a chemical compound with the molecular formula C11H22Cl2N2O and a molecular weight of 269.21 g/mol. IUPAC name: 9-methyl-3,9-diazaspiro[5.6]dodecan-10-one;dihydrochloride. InChIKey: JNGFQPLNWXXUTN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22Cl2N2O
Molecular weight269.21 g/mol
IUPAC name9-methyl-3,9-diazaspiro[5.6]dodecan-10-one;dihydrochloride
InChIKeyJNGFQPLNWXXUTN-UHFFFAOYSA-N
SMILESCN1CCC2(CCC1=O)CCNCC2.Cl.Cl

Computed by PubChem (NCBI)