CAS 1170155-67-5 appears in our catalog under these names: Cyclizine-d3 (N-methyl-d3), >95% (HPLC), Cyclizine-d3 (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Cyclizine-d3. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 5 mg, 25 mg, 10 mg.
1-benzhydryl-4-(trideuteriomethyl)piperazine (CAS 1170155-67-5) is a chemical compound with the molecular formula C18H22N2 and a molecular weight of 269.4 g/mol. IUPAC name: 1-benzhydryl-4-(trideuteriomethyl)piperazine. InChIKey: UVKZSORBKUEBAZ-FIBGUPNXSA-N.
| Molecular formula | C18H22N2 |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | 1-benzhydryl-4-(trideuteriomethyl)piperazine |
| InChIKey | UVKZSORBKUEBAZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)