CAS 1170171-95-5 is the registry number for 4-((2,3-Dioxo-4-(pyridin-2-ylmethyl)piperazin-1-yl)methyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[2,3-dioxo-4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]benzoic acid (CAS 1170171-95-5) is a chemical compound with the molecular formula C18H17N3O4 and a molecular weight of 339.3 g/mol. IUPAC name: 4-[[2,3-dioxo-4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]benzoic acid. InChIKey: OKBNETPCFGFSEU-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O4 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 4-[[2,3-dioxo-4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]benzoic acid |
| InChIKey | OKBNETPCFGFSEU-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C(=O)N1CC2=CC=C(C=C2)C(=O)O)CC3=CC=CC=N3 |
Computed by PubChem (NCBI)