CAS 1173681-44-1 is the registry number for (2S)-2-{((3-Oxo-3,4-dihydro-1(2H)-quinoxalinyl)carbonyl)amino}-3-phenylpropanoic Acid. Offered by: TRC. Available pack sizes: 2,5g.
(2S)-2-[(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)amino]-3-phenylpropanoic acid (CAS 1173681-44-1) is a chemical compound with the molecular formula C18H17N3O4 and a molecular weight of 339.3 g/mol. IUPAC name: (2S)-2-[(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)amino]-3-phenylpropanoic acid. InChIKey: PTEUELDWMJPCTL-AWEZNQCLSA-N.
| Molecular formula | C18H17N3O4 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | (2S)-2-[(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)amino]-3-phenylpropanoic acid |
| InChIKey | PTEUELDWMJPCTL-AWEZNQCLSA-N |
| SMILES | C1C(=O)NC2=CC=CC=C2N1C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)