CAS 1170296-25-9 appears in our catalog under these names: 4-{[2-(4-Fluorophenyl)pyrimidin-4-yl]oxy}benzoic acid, 98%, 98%, 4-((2-(4-Fluorophenyl)pyrimidin-4-yl)oxy)benzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4-[2-(4-fluorophenyl)pyrimidin-4-yl]oxybenzoic acid (CAS 1170296-25-9) is a chemical compound with the molecular formula C17H11FN2O3 and a molecular weight of 310.28 g/mol. IUPAC name: 4-[2-(4-fluorophenyl)pyrimidin-4-yl]oxybenzoic acid. InChIKey: WKHYZSWEHZDSCE-UHFFFAOYSA-N.
| Molecular formula | C17H11FN2O3 |
|---|---|
| Molecular weight | 310.28 g/mol |
| IUPAC name | 4-[2-(4-fluorophenyl)pyrimidin-4-yl]oxybenzoic acid |
| InChIKey | WKHYZSWEHZDSCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CC(=N2)OC3=CC=C(C=C3)C(=O)O)F |
Computed by PubChem (NCBI)