Products 1170530-26-3

CAS 1170530-26-3 is the registry number for 4-[6-(4-Fluorophenoxy)pyridazin-3-yl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[6-(4-fluorophenoxy)pyridazin-3-yl]benzoic acid (CAS 1170530-26-3) is a chemical compound with the molecular formula C17H11FN2O3 and a molecular weight of 310.28 g/mol. IUPAC name: 4-[6-(4-fluorophenoxy)pyridazin-3-yl]benzoic acid. InChIKey: VSNXRKXARRVLGL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H11FN2O3
Molecular weight310.28 g/mol
IUPAC name4-[6-(4-fluorophenoxy)pyridazin-3-yl]benzoic acid
InChIKeyVSNXRKXARRVLGL-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NN=C(C=C2)OC3=CC=C(C=C3)F)C(=O)O

Computed by PubChem (NCBI)