Products 1170356-75-8
CAS 1170356-75-8 is the registry number for 3-(3-Aminopropyl)-1-phenyl-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-aminopropyl)-1-phenylpyrazol-5-amine (CAS 1170356-75-8) is a chemical compound with the molecular formula C12H16N4 and a molecular weight of 216.28 g/mol. IUPAC name: 3-(3-aminopropyl)-1-phenylpyrazol-5-amine. InChIKey: PYJQFEIWSPVLHX-UHFFFAOYSA-N.
| Molecular formula | C12H16N4 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 3-(3-aminopropyl)-1-phenylpyrazol-5-amine |
| InChIKey | PYJQFEIWSPVLHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)CCCN)N |
Computed by PubChem (NCBI)