CAS 1170384-79-8 is the registry number for 1-(4-(1-Aminoethyl)phenyl)-1H-1,2,3-triazole-4-carboxamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1-[4-(1-aminoethyl)phenyl]triazole-4-carboxamide;hydrochloride (CAS 1170384-79-8) is a chemical compound with the molecular formula C11H14ClN5O and a molecular weight of 267.71 g/mol. IUPAC name: 1-[4-(1-aminoethyl)phenyl]triazole-4-carboxamide;hydrochloride. InChIKey: IFOULNKFPQRJAS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN5O |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 1-[4-(1-aminoethyl)phenyl]triazole-4-carboxamide;hydrochloride |
| InChIKey | IFOULNKFPQRJAS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)N2C=C(N=N2)C(=O)N)N.Cl |
Computed by PubChem (NCBI)