CAS 2022943-79-7 is the registry number for Abacavir Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(1R,3S)-3-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol (CAS 2022943-79-7) is a chemical compound with the molecular formula C11H14ClN5O and a molecular weight of 267.71 g/mol. IUPAC name: [(1R,3S)-3-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol. InChIKey: DOKOPGLGDNHBAS-RQJHMYQMSA-N.
| Molecular formula | C11H14ClN5O |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | [(1R,3S)-3-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol |
| InChIKey | DOKOPGLGDNHBAS-RQJHMYQMSA-N |
| SMILES | C1C[C@@H](C[C@@H]1CO)N2C=NC3=C2N=C(N=C3Cl)N |
Computed by PubChem (NCBI)