Products 2022943-79-7

CAS 2022943-79-7 is the registry number for Abacavir Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[(1R,3S)-3-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol (CAS 2022943-79-7) is a chemical compound with the molecular formula C11H14ClN5O and a molecular weight of 267.71 g/mol. IUPAC name: [(1R,3S)-3-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol. InChIKey: DOKOPGLGDNHBAS-RQJHMYQMSA-N.

Identity
Molecular formulaC11H14ClN5O
Molecular weight267.71 g/mol
IUPAC name[(1R,3S)-3-(2-amino-6-chloropurin-9-yl)cyclopentyl]methanol
InChIKeyDOKOPGLGDNHBAS-RQJHMYQMSA-N
SMILESC1C[C@@H](C[C@@H]1CO)N2C=NC3=C2N=C(N=C3Cl)N

Computed by PubChem (NCBI)