CAS 1170403-82-3 is the registry number for 5'-Nitro-2-oxo-2H-[1,2'-bipyridine]-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-nitro-2-pyridinyl)-2-oxopyridine-3-carboxylic acid (CAS 1170403-82-3) is a chemical compound with the molecular formula C11H7N3O5 and a molecular weight of 261.19 g/mol. IUPAC name: 1-(5-nitro-2-pyridinyl)-2-oxopyridine-3-carboxylic acid. InChIKey: GDFASEAHMVDCOE-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O5 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | 1-(5-nitro-2-pyridinyl)-2-oxopyridine-3-carboxylic acid |
| InChIKey | GDFASEAHMVDCOE-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)C(=O)O)C2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)