Products 1170403-82-3

CAS 1170403-82-3 is the registry number for 5'-Nitro-2-oxo-2H-[1,2'-bipyridine]-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(5-nitro-2-pyridinyl)-2-oxopyridine-3-carboxylic acid (CAS 1170403-82-3) is a chemical compound with the molecular formula C11H7N3O5 and a molecular weight of 261.19 g/mol. IUPAC name: 1-(5-nitro-2-pyridinyl)-2-oxopyridine-3-carboxylic acid. InChIKey: GDFASEAHMVDCOE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7N3O5
Molecular weight261.19 g/mol
IUPAC name1-(5-nitro-2-pyridinyl)-2-oxopyridine-3-carboxylic acid
InChIKeyGDFASEAHMVDCOE-UHFFFAOYSA-N
SMILESC1=CN(C(=O)C(=C1)C(=O)O)C2=NC=C(C=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)