CAS 197310-95-5 is the registry number for (2Z)-2-Cyano-3-(6-nitro-1,3-benzodioxol-5-yl)acrylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(Z)-2-cyano-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide (CAS 197310-95-5) is a chemical compound with the molecular formula C11H7N3O5 and a molecular weight of 261.19 g/mol. IUPAC name: (Z)-2-cyano-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide. InChIKey: UAEKMEVZWPTWHZ-XFSBKJJWSA-N.
| Molecular formula | C11H7N3O5 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | (Z)-2-cyano-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
| InChIKey | UAEKMEVZWPTWHZ-XFSBKJJWSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)/C=C(/C#N)\C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)