CAS 1170478-53-1 is the registry number for 1-[(2,3,5,6-Tetramethylphenyl)sulfonyl]piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine;hydrochloride (CAS 1170478-53-1) is a chemical compound with the molecular formula C14H23ClN2O2S and a molecular weight of 318.9 g/mol. IUPAC name: 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine;hydrochloride. InChIKey: OOQOXTUZTAEYDB-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O2S |
|---|---|
| Molecular weight | 318.9 g/mol |
| IUPAC name | 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | OOQOXTUZTAEYDB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)N2CCNCC2)C)C.Cl |
Computed by PubChem (NCBI)