CAS 1171234-46-0 appears in our catalog under these names: 1-[(4-Sec-butylphenyl)sulfonyl]piperazine hydrochloride, 95%, 1-(4-(Butan-2-yl)benzenesulfonyl)piperazine hydrochloride, 95%, 1-(4-(Butan-2-yl)benzenesulfonyl)piperazine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 2,5g.
1-(4-butan-2-ylphenyl)sulfonylpiperazine;hydrochloride (CAS 1171234-46-0) is a chemical compound with the molecular formula C14H23ClN2O2S and a molecular weight of 318.9 g/mol. IUPAC name: 1-(4-butan-2-ylphenyl)sulfonylpiperazine;hydrochloride. InChIKey: AUIMCRHZJHZROW-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O2S |
|---|---|
| Molecular weight | 318.9 g/mol |
| IUPAC name | 1-(4-butan-2-ylphenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | AUIMCRHZJHZROW-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC=C(C=C1)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)