Products 1170480-45-1

CAS 1170480-45-1 is the registry number for 1-Aminopropan-2-yl piperidine-4-carboxylate dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-aminopropan-2-yl piperidine-4-carboxylate;dihydrochloride (CAS 1170480-45-1) is a chemical compound with the molecular formula C9H20Cl2N2O2 and a molecular weight of 259.17 g/mol. IUPAC name: 1-aminopropan-2-yl piperidine-4-carboxylate;dihydrochloride. InChIKey: SEKPCJUROMDUJM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H20Cl2N2O2
Molecular weight259.17 g/mol
IUPAC name1-aminopropan-2-yl piperidine-4-carboxylate;dihydrochloride
InChIKeySEKPCJUROMDUJM-UHFFFAOYSA-N
SMILESCC(CN)OC(=O)C1CCNCC1.Cl.Cl

Computed by PubChem (NCBI)