CAS 1609403-33-9 is the registry number for Trans-4-(1,4-diazepan-1-yl)tetrahydro-3-furanol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3R,4S)-4-(1,4-diazepan-1-yl)oxolan-3-ol;dihydrochloride (CAS 1609403-33-9) is a chemical compound with the molecular formula C9H20Cl2N2O2 and a molecular weight of 259.17 g/mol. IUPAC name: (3R,4S)-4-(1,4-diazepan-1-yl)oxolan-3-ol;dihydrochloride. InChIKey: GHVHHLANWDFGPX-CDEWPDHBSA-N.
| Molecular formula | C9H20Cl2N2O2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | (3R,4S)-4-(1,4-diazepan-1-yl)oxolan-3-ol;dihydrochloride |
| InChIKey | GHVHHLANWDFGPX-CDEWPDHBSA-N |
| SMILES | C1CNCCN(C1)[C@H]2COC[C@@H]2O.Cl.Cl |
Computed by PubChem (NCBI)