Products 1170520-94-1
CAS 1170520-94-1 is the registry number for 7-Amino-3,3,5-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-amino-3,3,5-trimethyl-2H-1,5-benzoxazepin-4-one (CAS 1170520-94-1) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 7-amino-3,3,5-trimethyl-2H-1,5-benzoxazepin-4-one. InChIKey: OJVZPMLBOVODEB-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 7-amino-3,3,5-trimethyl-2H-1,5-benzoxazepin-4-one |
| InChIKey | OJVZPMLBOVODEB-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C(C=C(C=C2)N)N(C1=O)C)C |
Computed by PubChem (NCBI)