CAS 1170546-94-7 is the registry number for 6-Methyl-4-oxo-3,4-dihydrothieno[3,2-d][1,2,3]triazine-7-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
6-methyl-4-oxo-3H-thieno[3,2-d]triazine-7-carboxylic acid (CAS 1170546-94-7) is a chemical compound with the molecular formula C7H5N3O3S and a molecular weight of 211.20 g/mol. IUPAC name: 6-methyl-4-oxo-3H-thieno[3,2-d]triazine-7-carboxylic acid. InChIKey: RJWUMDXQINDTFM-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3S |
|---|---|
| Molecular weight | 211.20 g/mol |
| IUPAC name | 6-methyl-4-oxo-3H-thieno[3,2-d]triazine-7-carboxylic acid |
| InChIKey | RJWUMDXQINDTFM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)C(=O)NN=N2)C(=O)O |
Computed by PubChem (NCBI)