CAS 460044-83-1 is the registry number for 2-Amino-6-Nitrobenzo(d)thiazol-4-ol, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
2-amino-6-nitro-1,3-benzothiazol-4-ol (CAS 460044-83-1) is a chemical compound with the molecular formula C7H5N3O3S and a molecular weight of 211.20 g/mol. IUPAC name: 2-amino-6-nitro-1,3-benzothiazol-4-ol. InChIKey: UBWOTKJTWBBNMA-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3S |
|---|---|
| Molecular weight | 211.20 g/mol |
| IUPAC name | 2-amino-6-nitro-1,3-benzothiazol-4-ol |
| InChIKey | UBWOTKJTWBBNMA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1O)N=C(S2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)