CAS 1170596-18-5 is the registry number for 3-(4-Chloro-2-(chloromethyl)phenoxymethyl)pyridine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[[4-chloro-2-(chloromethyl)phenoxy]methyl]pyridine;hydrochloride (CAS 1170596-18-5) is a chemical compound with the molecular formula C13H12Cl3NO and a molecular weight of 304.6 g/mol. IUPAC name: 3-[[4-chloro-2-(chloromethyl)phenoxy]methyl]pyridine;hydrochloride. InChIKey: ZLGXSDUFZLYPNS-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl3NO |
|---|---|
| Molecular weight | 304.6 g/mol |
| IUPAC name | 3-[[4-chloro-2-(chloromethyl)phenoxy]methyl]pyridine;hydrochloride |
| InChIKey | ZLGXSDUFZLYPNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)COC2=C(C=C(C=C2)Cl)CCl.Cl |
Computed by PubChem (NCBI)