CAS 1803582-98-0 is the registry number for (4-(3,5-Dichlorophenoxy)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[4-(3,5-dichlorophenoxy)phenyl]methanamine;hydrochloride (CAS 1803582-98-0) is a chemical compound with the molecular formula C13H12Cl3NO and a molecular weight of 304.6 g/mol. IUPAC name: [4-(3,5-dichlorophenoxy)phenyl]methanamine;hydrochloride. InChIKey: MXPXFJLVMSAYBZ-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl3NO |
|---|---|
| Molecular weight | 304.6 g/mol |
| IUPAC name | [4-(3,5-dichlorophenoxy)phenyl]methanamine;hydrochloride |
| InChIKey | MXPXFJLVMSAYBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)OC2=CC(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)