CAS 1170601-73-6 is the registry number for 2-Chloro-n-(4-piperidin-1-ylphenyl)acetamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-chloro-N-(4-piperidin-1-ylphenyl)acetamide;hydrochloride (CAS 1170601-73-6) is a chemical compound with the molecular formula C13H18Cl2N2O and a molecular weight of 289.20 g/mol. IUPAC name: 2-chloro-N-(4-piperidin-1-ylphenyl)acetamide;hydrochloride. InChIKey: SCSIXPFKBYVOAJ-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl2N2O |
|---|---|
| Molecular weight | 289.20 g/mol |
| IUPAC name | 2-chloro-N-(4-piperidin-1-ylphenyl)acetamide;hydrochloride |
| InChIKey | SCSIXPFKBYVOAJ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=C(C=C2)NC(=O)CCl.Cl |
Computed by PubChem (NCBI)