Products 76087-89-3

CAS 76087-89-3 is the registry number for 1-(4-Benzyl-piperazin-1-yl)-2-chloro-ethanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1-(4-benzylpiperazin-1-yl)-2-chloroethanone;hydrochloride (CAS 76087-89-3) is a chemical compound with the molecular formula C13H18Cl2N2O and a molecular weight of 289.20 g/mol. IUPAC name: 1-(4-benzylpiperazin-1-yl)-2-chloroethanone;hydrochloride. InChIKey: BLUWTCAQSQQYSH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18Cl2N2O
Molecular weight289.20 g/mol
IUPAC name1-(4-benzylpiperazin-1-yl)-2-chloroethanone;hydrochloride
InChIKeyBLUWTCAQSQQYSH-UHFFFAOYSA-N
SMILESC1CN(CCN1CC2=CC=CC=C2)C(=O)CCl.Cl

Computed by PubChem (NCBI)